C25H21N7O5 — CID 23488375
N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 23488375) has the molecular formula C25H21N7O5 and a molecular weight of 499.49 g/mol. Its IUPAC name is N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23488375 |
| Molecular Formula | C25H21N7O5 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21N7O5/c33-25(20-12-7-13-21(14-20)31(34)35)29-28-23-22(32(36)37)24(27-17-26-23)30(15-18-8-3-1-4-9-18)16-19-10-5-2-6-11-19/h1-14,17H,15-16H2,(H,29,33)(H,26,27,28) |
| InChIKey | WBOMLTVDWHDOGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|