C23H18ClN7O3 — CID 22536200
N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 22536200) has the molecular formula C23H18ClN7O3 and a molecular weight of 475.90 g/mol. Its IUPAC name is N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 22536200 |
| Molecular Formula | C23H18ClN7O3 |
| Molecular Weight | 475.90 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | N'-[6-[benzyl(pyridin-2-yl)amino]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | O=C(NNc1ncnc(N(Cc2ccccc2)c2ccccn2)c1[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClN7O3/c24-18-10-6-9-17(13-18)23(32)29-28-21-20(31(33)34)22(27-15-26-21)30(19-11-4-5-12-25-19)14-16-7-2-1-3-8-16/h1-13,15H,14H2,(H,29,32)(H,26,27,28) |
| InChIKey | YPDWTNMMTNFMOQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|