C25H21ClN6O3 — CID 23488377
3-chloro-N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23488377) has the molecular formula C25H21ClN6O3 and a molecular weight of 488.94 g/mol. Its IUPAC name is 3-chloro-N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 3-chloro-N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23488377 |
| Molecular Formula | C25H21ClN6O3 |
| Molecular Weight | 488.94 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-chloro-N'-[6-(dibenzylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H21ClN6O3/c26-21-13-7-12-20(14-21)25(33)30-29-23-22(32(34)35)24(28-17-27-23)31(15-18-8-3-1-4-9-18)16-19-10-5-2-6-11-19/h1-14,17H,15-16H2,(H,30,33)(H,27,28,29) |
| InChIKey | LDQIUJMJCDIMBU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|