C24H20ClN5O2 — CID 23488339
4-N,4-N-dibenzyl-6-N-(3-chlorophenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23488339) has the molecular formula C24H20ClN5O2 and a molecular weight of 445.91 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-(3-chlorophenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-(3-chlorophenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23488339 |
| Molecular Formula | C24H20ClN5O2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-(3-chlorophenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(Cl)c2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H20ClN5O2/c25-20-12-7-13-21(14-20)28-23-22(30(31)32)24(27-17-26-23)29(15-18-8-3-1-4-9-18)16-19-10-5-2-6-11-19/h1-14,17H,15-16H2,(H,26,27,28) |
| InChIKey | VVKWLBSQZDNKLW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|