C21H18N6O2S — CID 23488332
4-N,4-N-dibenzyl-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 23488332) has the molecular formula C21H18N6O2S and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dibenzyl-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23488332 |
| Molecular Formula | C21H18N6O2S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 4-N,4-N-dibenzyl-5-nitro-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2nccs2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H18N6O2S/c28-27(29)18-19(25-21-22-11-12-30-21)23-15-24-20(18)26(13-16-7-3-1-4-8-16)14-17-9-5-2-6-10-17/h1-12,15H,13-14H2,(H,22,23,24,25) |
| InChIKey | SMKWTQVPRCNQLA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|