C25H29N5O2 — CID 23488429
4-N,4-N-dibenzyl-6-N-cycloheptyl-5-nitropyrimidine-4,6-diamine (PubChem CID 23488429) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-cycloheptyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-cycloheptyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23488429 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-cycloheptyl-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NC2CCCCCC2)ncnc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H29N5O2/c31-30(32)23-24(28-22-15-9-1-2-10-16-22)26-19-27-25(23)29(17-20-11-5-3-6-12-20)18-21-13-7-4-8-14-21/h3-8,11-14,19,22H,1-2,9-10,15-18H2,(H,26,27,28) |
| InChIKey | OHKZFRKGYNZOMY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|