C24H26N6O4 — CID 140662189
[[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino] piperidine-1-carboxylate (PubChem CID 140662189) has the molecular formula C24H26N6O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is [[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino] piperidine-1-carboxylate.
| Compound Name | [[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140662189 |
| Molecular Formula | C24H26N6O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [[6-(dibenzylamino)-5-nitropyrimidin-4-yl]amino] piperidine-1-carboxylate |
| SMILES | O=C(ONc1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1[N+](=O)[O-])N1CCCCC1 |
| InChI | InChI=1S/C24H26N6O4/c31-24(28-14-8-3-9-15-28)34-27-22-21(30(32)33)23(26-18-25-22)29(16-19-10-4-1-5-11-19)17-20-12-6-2-7-13-20/h1-2,4-7,10-13,18H,3,8-9,14-17H2,(H,25,26,27) |
| InChIKey | YPVYVDHJASHCID-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|