C14H12N6O2S — CID 22526939
4-N-methyl-5-nitro-4-N-phenyl-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine (PubChem CID 22526939) has the molecular formula C14H12N6O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-N-methyl-5-nitro-4-N-phenyl-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-methyl-5-nitro-4-N-phenyl-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526939 |
| Molecular Formula | C14H12N6O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-N-methyl-5-nitro-4-N-phenyl-6-N-(1,3-thiazol-2-yl)pyrimidine-4,6-diamine |
| SMILES | CN(c1ccccc1)c1ncnc(Nc2nccs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N6O2S/c1-19(10-5-3-2-4-6-10)13-11(20(21)22)12(16-9-17-13)18-14-15-7-8-23-14/h2-9H,1H3,(H,15,16,17,18) |
| InChIKey | DYFFXCPWLOQPIU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|