C19H16N6O3S — CID 22526972
6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 22526972) has the molecular formula C19H16N6O3S and a molecular weight of 408.44 g/mol. Its IUPAC name is 6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526972 |
| Molecular Formula | C19H16N6O3S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | COc1ccc2nc(Nc3ncnc(N(C)c4ccccc4)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H16N6O3S/c1-24(12-6-4-3-5-7-12)18-16(25(26)27)17(20-11-21-18)23-19-22-14-9-8-13(28-2)10-15(14)29-19/h3-11H,1-2H3,(H,20,21,22,23) |
| InChIKey | HLZMTLXRMWNABJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|