C21H20N6O3S — CID 23477797
4-N-ethyl-6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23477797) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 4-N-ethyl-6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23477797 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-N-ethyl-6-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCN(c1cccc(C)c1)c1ncnc(Nc2nc3ccc(OC)cc3s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20N6O3S/c1-4-26(14-7-5-6-13(2)10-14)20-18(27(28)29)19(22-12-23-20)25-21-24-16-9-8-15(30-3)11-17(16)31-21/h5-12H,4H2,1-3H3,(H,22,23,24,25) |
| InChIKey | AIFQKTDDCAKGOP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|