C20H20ClN5O3 — CID 23477672
6-N-(5-chloro-2-methoxyphenyl)-4-N-ethyl-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23477672) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is 6-N-(5-chloro-2-methoxyphenyl)-4-N-ethyl-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(5-chloro-2-methoxyphenyl)-4-N-ethyl-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23477672 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 6-N-(5-chloro-2-methoxyphenyl)-4-N-ethyl-4-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCN(c1cccc(C)c1)c1ncnc(Nc2cc(Cl)ccc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20ClN5O3/c1-4-25(15-7-5-6-13(2)10-15)20-18(26(27)28)19(22-12-23-20)24-16-11-14(21)8-9-17(16)29-3/h5-12H,4H2,1-3H3,(H,22,23,24) |
| InChIKey | HXDGECXKDPFKIT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|