C12H8ClN5O3S — CID 23477358
N-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 23477358) has the molecular formula C12H8ClN5O3S and a molecular weight of 337.75 g/mol. Its IUPAC name is N-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 23477358 |
| Molecular Formula | C12H8ClN5O3S |
| Molecular Weight | 337.75 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-(6-chloro-5-nitropyrimidin-4-yl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3ncnc(Cl)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C12H8ClN5O3S/c1-21-6-2-3-7-8(4-6)22-12(16-7)17-11-9(18(19)20)10(13)14-5-15-11/h2-5H,1H3,(H,14,15,16,17) |
| InChIKey | SAQLMPMRFPAHOJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|