C11H5ClFN5O2S — CID 108776007
N-(6-chloro-5-nitropyrimidin-4-yl)-6-fluoro-1,3-benzothiazol-2-amine (PubChem CID 108776007) has the molecular formula C11H5ClFN5O2S and a molecular weight of 325.71 g/mol. Its IUPAC name is N-(6-chloro-5-nitropyrimidin-4-yl)-6-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-(6-chloro-5-nitropyrimidin-4-yl)-6-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 108776007 |
| Molecular Formula | C11H5ClFN5O2S |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | N-(6-chloro-5-nitropyrimidin-4-yl)-6-fluoro-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C11H5ClFN5O2S/c12-9-8(18(19)20)10(15-4-14-9)17-11-16-6-2-1-5(13)3-7(6)21-11/h1-4H,(H,14,15,16,17) |
| InChIKey | JILKTFDQMATPFI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|