C16H16ClN7O4S2 — CID 108777327
N-(6-chloro-5-nitropyrimidin-4-yl)-6-(4-methylpiperazin-1-yl)sulfonyl-1,3-benzothiazol-2-amine (PubChem CID 108777327) has the molecular formula C16H16ClN7O4S2 and a molecular weight of 469.94 g/mol. Its IUPAC name is N-(6-chloro-5-nitropyrimidin-4-yl)-6-(4-methylpiperazin-1-yl)sulfonyl-1,3-benzothiazol-2-amine.
| Compound Name | N-(6-chloro-5-nitropyrimidin-4-yl)-6-(4-methylpiperazin-1-yl)sulfonyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 108777327 |
| Molecular Formula | C16H16ClN7O4S2 |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | N-(6-chloro-5-nitropyrimidin-4-yl)-6-(4-methylpiperazin-1-yl)sulfonyl-1,3-benzothiazol-2-amine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc3nc(Nc4ncnc(Cl)c4[N+](=O)[O-])sc3c2)CC1 |
| InChI | InChI=1S/C16H16ClN7O4S2/c1-22-4-6-23(7-5-22)30(27,28)10-2-3-11-12(8-10)29-16(20-11)21-15-13(24(25)26)14(17)18-9-19-15/h2-3,8-9H,4-7H2,1H3,(H,18,19,20,21) |
| InChIKey | OJUKRMNKALMIBS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|