C10H5Cl2FN4O2 — CID 62101185
6-chloro-N-(5-chloro-2-fluorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 62101185) has the molecular formula C10H5Cl2FN4O2 and a molecular weight of 303.08 g/mol. Its IUPAC name is 6-chloro-N-(5-chloro-2-fluorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-(5-chloro-2-fluorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 62101185 |
| Molecular Formula | C10H5Cl2FN4O2 |
| Molecular Weight | 303.08 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 6-chloro-N-(5-chloro-2-fluorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H5Cl2FN4O2/c11-5-1-2-6(13)7(3-5)16-10-8(17(18)19)9(12)14-4-15-10/h1-4H,(H,14,15,16) |
| InChIKey | AYQVGYZOKQHMQZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|