C10H3ClF4N4O2 — CID 107645593
6-chloro-5-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-4-amine (PubChem CID 107645593) has the molecular formula C10H3ClF4N4O2 and a molecular weight of 322.61 g/mol. Its IUPAC name is 6-chloro-5-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107645593 |
| Molecular Formula | C10H3ClF4N4O2 |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 6-chloro-5-nitro-N-(2,3,5,6-tetrafluorophenyl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H3ClF4N4O2/c11-9-8(19(20)21)10(17-2-16-9)18-7-5(14)3(12)1-4(13)6(7)15/h1-2H,(H,16,17,18) |
| InChIKey | FVTGKMCZXJQKNP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|