C10H7Cl2FN6O2 — CID 107581042
N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 107581042) has the molecular formula C10H7Cl2FN6O2 and a molecular weight of 333.11 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 107581042 |
| Molecular Formula | C10H7Cl2FN6O2 |
| Molecular Weight | 333.11 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | NNc1ncnc(Nc2cc(Cl)c(F)c(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7Cl2FN6O2/c11-5-1-4(2-6(12)7(5)13)17-9-8(19(20)21)10(18-14)16-3-15-9/h1-3H,14H2,(H2,15,16,17,18) |
| InChIKey | SKXVWTIHYGPBGF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|