C10H7F3N6O2 — CID 80904013
6-hydrazinyl-5-nitro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine (PubChem CID 80904013) has the molecular formula C10H7F3N6O2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 6-hydrazinyl-5-nitro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-5-nitro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80904013 |
| Molecular Formula | C10H7F3N6O2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 6-hydrazinyl-5-nitro-N-(2,3,5-trifluorophenyl)pyrimidin-4-amine |
| SMILES | NNc1ncnc(Nc2cc(F)cc(F)c2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F3N6O2/c11-4-1-5(12)7(13)6(2-4)17-9-8(19(20)21)10(18-14)16-3-15-9/h1-3H,14H2,(H2,15,16,17,18) |
| InChIKey | XPKDAJNSQWTTRH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|