C11H10F2N6O2 — CID 80907475
N-[(2,5-difluorophenyl)methyl]-6-hydrazinyl-5-nitropyrimidin-4-amine (PubChem CID 80907475) has the molecular formula C11H10F2N6O2 and a molecular weight of 296.24 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-6-hydrazinyl-5-nitropyrimidin-4-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-6-hydrazinyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80907475 |
| Molecular Formula | C11H10F2N6O2 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-6-hydrazinyl-5-nitropyrimidin-4-amine |
| SMILES | NNc1ncnc(NCc2cc(F)ccc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F2N6O2/c12-7-1-2-8(13)6(3-7)4-15-10-9(19(20)21)11(18-14)17-5-16-10/h1-3,5H,4,14H2,(H2,15,16,17,18) |
| InChIKey | PYEMWDNBYAOQJI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|