C11H10F2N4O2 — CID 103079923
N-[(2,5-difluorophenyl)methyl]-1-methyl-4-nitropyrazol-3-amine (PubChem CID 103079923) has the molecular formula C11H10F2N4O2 and a molecular weight of 268.22 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1-methyl-4-nitropyrazol-3-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1-methyl-4-nitropyrazol-3-amine |
|---|---|
| PubChem CID | 103079923 |
| Molecular Formula | C11H10F2N4O2 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1-methyl-4-nitropyrazol-3-amine |
| SMILES | Cn1cc([N+](=O)[O-])c(NCc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C11H10F2N4O2/c1-16-6-10(17(18)19)11(15-16)14-5-7-4-8(12)2-3-9(7)13/h2-4,6H,5H2,1H3,(H,14,15) |
| InChIKey | QKYMAZGMKSKOOS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|