C12H12N4O4 — CID 103079778
N-(1,3-benzodioxol-4-ylmethyl)-1-methyl-4-nitropyrazol-3-amine (PubChem CID 103079778) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-1-methyl-4-nitropyrazol-3-amine.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-1-methyl-4-nitropyrazol-3-amine |
|---|---|
| PubChem CID | 103079778 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-1-methyl-4-nitropyrazol-3-amine |
| SMILES | Cn1cc([N+](=O)[O-])c(NCc2cccc3c2OCO3)n1 |
| InChI | InChI=1S/C12H12N4O4/c1-15-6-9(16(17)18)12(14-15)13-5-8-3-2-4-10-11(8)20-7-19-10/h2-4,6H,5,7H2,1H3,(H,13,14) |
| InChIKey | OEZZDEJYHCBWEN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|