C7H8N6O3 — CID 106403084
1-methyl-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyrazol-3-amine (PubChem CID 106403084) has the molecular formula C7H8N6O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyrazol-3-amine.
| Compound Name | 1-methyl-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 106403084 |
| Molecular Formula | C7H8N6O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-methyl-4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)pyrazol-3-amine |
| SMILES | Cn1cc([N+](=O)[O-])c(NCc2ncon2)n1 |
| InChI | InChI=1S/C7H8N6O3/c1-12-3-5(13(14)15)7(10-12)8-2-6-9-4-16-11-6/h3-4H,2H2,1H3,(H,8,10) |
| InChIKey | LAJHRMYOWIJFEB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|