C8H9N5O2S — CID 103079787
1-methyl-4-nitro-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine (PubChem CID 103079787) has the molecular formula C8H9N5O2S and a molecular weight of 239.26 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine.
| Compound Name | 1-methyl-4-nitro-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 103079787 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-methyl-4-nitro-N-(1,3-thiazol-2-ylmethyl)pyrazol-3-amine |
| SMILES | Cn1cc([N+](=O)[O-])c(NCc2nccs2)n1 |
| InChI | InChI=1S/C8H9N5O2S/c1-12-5-6(13(14)15)8(11-12)10-4-7-9-2-3-16-7/h2-3,5H,4H2,1H3,(H,10,11) |
| InChIKey | FYGHPWFKQFTLKH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|