C12H14N6O2 — CID 80899344
6-hydrazinyl-N-[(3-methylphenyl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 80899344) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-hydrazinyl-N-[(3-methylphenyl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-[(3-methylphenyl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80899344 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6-hydrazinyl-N-[(3-methylphenyl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1cccc(CNc2ncnc(NN)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N6O2/c1-8-3-2-4-9(5-8)6-14-11-10(18(19)20)12(17-13)16-7-15-11/h2-5,7H,6,13H2,1H3,(H2,14,15,16,17) |
| InChIKey | ZWWPINPMHQUDQY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|