C8H10N8O3 — CID 114185580
6-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 114185580) has the molecular formula C8H10N8O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is 6-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 114185580 |
| Molecular Formula | C8H10N8O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 6-hydrazinyl-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cc1nc(CNc2ncnc(NN)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C8H10N8O3/c1-4-13-5(15-19-4)2-10-7-6(16(17)18)8(14-9)12-3-11-7/h3H,2,9H2,1H3,(H2,10,11,12,14) |
| InChIKey | AHJNUBFESSGFHT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|