C11H14N6O3 — CID 106424721
3-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline (PubChem CID 106424721) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 3-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline.
| Compound Name | 3-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 106424721 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-2-nitroaniline |
| SMILES | Cc1nc(CCNc2cccc(NN)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C11H14N6O3/c1-7-14-10(16-20-7)5-6-13-8-3-2-4-9(15-12)11(8)17(18)19/h2-4,13,15H,5-6,12H2,1H3 |
| InChIKey | IPNAQLJWFUKBBK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|