C11H11IN4O3 — CID 106418550
2-iodo-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitroaniline (PubChem CID 106418550) has the molecular formula C11H11IN4O3 and a molecular weight of 374.14 g/mol. Its IUPAC name is 2-iodo-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitroaniline.
| Compound Name | 2-iodo-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 106418550 |
| Molecular Formula | C11H11IN4O3 |
| Molecular Weight | 374.14 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-iodo-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-4-nitroaniline |
| SMILES | Cc1nc(CCNc2ccc([N+](=O)[O-])cc2I)no1 |
| InChI | InChI=1S/C11H11IN4O3/c1-7-14-11(15-19-7)4-5-13-10-3-2-8(16(17)18)6-9(10)12/h2-3,6,13H,4-5H2,1H3 |
| InChIKey | NSCNOJQYZRRLGH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.14 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|