C13H22N4O2 — CID 115327795
3-hydrazinyl-N-(5-methylhexyl)-2-nitroaniline (PubChem CID 115327795) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-hydrazinyl-N-(5-methylhexyl)-2-nitroaniline.
| Compound Name | 3-hydrazinyl-N-(5-methylhexyl)-2-nitroaniline |
|---|---|
| PubChem CID | 115327795 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-hydrazinyl-N-(5-methylhexyl)-2-nitroaniline |
| SMILES | CC(C)CCCCNc1cccc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H22N4O2/c1-10(2)6-3-4-9-15-11-7-5-8-12(16-14)13(11)17(18)19/h5,7-8,10,15-16H,3-4,6,9,14H2,1-2H3 |
| InChIKey | MOEVXFXWWAUVKI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|