C13H21N3O3 — CID 106138170
5-[3-(ethylamino)-2-nitroanilino]pentan-2-ol (PubChem CID 106138170) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 5-[3-(ethylamino)-2-nitroanilino]pentan-2-ol.
| Compound Name | 5-[3-(ethylamino)-2-nitroanilino]pentan-2-ol |
|---|---|
| PubChem CID | 106138170 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-[3-(ethylamino)-2-nitroanilino]pentan-2-ol |
| SMILES | CCNc1cccc(NCCCC(C)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N3O3/c1-3-14-11-7-4-8-12(13(11)16(18)19)15-9-5-6-10(2)17/h4,7-8,10,14-15,17H,3,5-6,9H2,1-2H3 |
| InChIKey | TYEYMUBHIKMUOA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|