nitric acid;(2,3,5-trifluorophenyl)hydrazine

C6H6F3N3O3 — CID 138620101

IUPACnitric acid;(2,3,5-trifluorophenyl)hydrazine
SMILESNNc1cc(F)cc(F)c1F.O=[N+]([O-])O
InChIInChI=1S/C6H5F3N2.HNO3/c7-3-1-4(8)6(9)5(2-3)11-10;2-1(3)4/h1-2,11H,10H2;(H,2,3,4)
InChIKeyXZSNHEQWNPDDMY-UHFFFAOYSA-N
MW225.13 g/mol
LogP1.04
Rot. Bonds1

About nitric acid;(2,3,5-trifluorophenyl)hydrazine

nitric acid;(2,3,5-trifluorophenyl)hydrazine (PubChem CID 138620101) has the molecular formula C6H6F3N3O3 and a molecular weight of 225.13 g/mol. Its IUPAC name is nitric acid;(2,3,5-trifluorophenyl)hydrazine.

Molecular Properties

Compound Namenitric acid;(2,3,5-trifluorophenyl)hydrazine
PubChem CID138620101
Molecular FormulaC6H6F3N3O3
Molecular Weight225.13 g/mol
Exact Mass225.04
IUPAC Namenitric acid;(2,3,5-trifluorophenyl)hydrazine
SMILESNNc1cc(F)cc(F)c1F.O=[N+]([O-])O
InChIInChI=1S/C6H5F3N2.HNO3/c7-3-1-4(8)6(9)5(2-3)11-10;2-1(3)4/h1-2,11H,10H2;(H,2,3,4)
InChIKeyXZSNHEQWNPDDMY-UHFFFAOYSA-N
XLogP1.04
TPSA101.42 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.13
LogP ≤ 51.04
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze nitric acid;(2,3,5-trifluorophenyl)hydrazine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of nitric acid;(2,3,5-trifluorophenyl)hydrazine?
The IUPAC name of nitric acid;(2,3,5-trifluorophenyl)hydrazine (CID 138620101) is nitric acid;(2,3,5-trifluorophenyl)hydrazine.
What is the SMILES notation for nitric acid;(2,3,5-trifluorophenyl)hydrazine?
The canonical SMILES for nitric acid;(2,3,5-trifluorophenyl)hydrazine is NNc1cc(F)cc(F)c1F.O=[N+]([O-])O.
What is the InChIKey of nitric acid;(2,3,5-trifluorophenyl)hydrazine?
The InChIKey is XZSNHEQWNPDDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2.HNO3/c7-3-1-4(8)6(9)5(2-3)11-10;2-1(3)4/h1-2,11H,10H2;(H,2,3,4).
What are the key properties of nitric acid;(2,3,5-trifluorophenyl)hydrazine?
nitric acid;(2,3,5-trifluorophenyl)hydrazine has a molecular weight of 225.13 g/mol, XLogP of 1.04, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;(2,3,5-trifluorophenyl)hydrazine is sourced from PubChem (CID 138620101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).