C6H6F3N3O3 — CID 138620101
nitric acid;(2,3,5-trifluorophenyl)hydrazine (PubChem CID 138620101) has the molecular formula C6H6F3N3O3 and a molecular weight of 225.13 g/mol. Its IUPAC name is nitric acid;(2,3,5-trifluorophenyl)hydrazine.
| Compound Name | nitric acid;(2,3,5-trifluorophenyl)hydrazine |
|---|---|
| PubChem CID | 138620101 |
| Molecular Formula | C6H6F3N3O3 |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | nitric acid;(2,3,5-trifluorophenyl)hydrazine |
| SMILES | NNc1cc(F)cc(F)c1F.O=[N+]([O-])O |
| InChI | InChI=1S/C6H5F3N2.HNO3/c7-3-1-4(8)6(9)5(2-3)11-10;2-1(3)4/h1-2,11H,10H2;(H,2,3,4) |
| InChIKey | XZSNHEQWNPDDMY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|