C13H8F3NO3 — CID 107703907
3,5-dihydroxy-N-(2,3,5-trifluorophenyl)benzamide (PubChem CID 107703907) has the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(2,3,5-trifluorophenyl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(2,3,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 107703907 |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3,5-dihydroxy-N-(2,3,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H8F3NO3/c14-7-3-10(15)12(16)11(4-7)17-13(20)6-1-8(18)5-9(19)2-6/h1-5,18-19H,(H,17,20) |
| InChIKey | DMXFILLGAVWUOZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|