C13H7ClF3NO2 — CID 62813735
5-chloro-2-hydroxy-N-(2,3,5-trifluorophenyl)benzamide (PubChem CID 62813735) has the molecular formula C13H7ClF3NO2 and a molecular weight of 301.65 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-(2,3,5-trifluorophenyl)benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-(2,3,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 62813735 |
| Molecular Formula | C13H7ClF3NO2 |
| Molecular Weight | 301.65 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 5-chloro-2-hydroxy-N-(2,3,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H7ClF3NO2/c14-6-1-2-11(19)8(3-6)13(20)18-10-5-7(15)4-9(16)12(10)17/h1-5,19H,(H,18,20) |
| InChIKey | VYINJPMKSKAJGE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|