C12H5F5N2O — CID 105381162
2,3-difluoro-N-(2,3,5-trifluorophenyl)pyridine-4-carboxamide (PubChem CID 105381162) has the molecular formula C12H5F5N2O and a molecular weight of 288.18 g/mol. Its IUPAC name is 2,3-difluoro-N-(2,3,5-trifluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(2,3,5-trifluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381162 |
| Molecular Formula | C12H5F5N2O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2,3-difluoro-N-(2,3,5-trifluorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)c1ccnc(F)c1F |
| InChI | InChI=1S/C12H5F5N2O/c13-5-3-7(14)10(16)8(4-5)19-12(20)6-1-2-18-11(17)9(6)15/h1-4H,(H,19,20) |
| InChIKey | ZKCGCIQZBCQZKX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|