C14H8F2N4O — CID 105380445
2,3-difluoro-N-quinoxalin-6-ylpyridine-4-carboxamide (PubChem CID 105380445) has the molecular formula C14H8F2N4O and a molecular weight of 286.24 g/mol. Its IUPAC name is 2,3-difluoro-N-quinoxalin-6-ylpyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-quinoxalin-6-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380445 |
| Molecular Formula | C14H8F2N4O |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2,3-difluoro-N-quinoxalin-6-ylpyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2nccnc2c1)c1ccnc(F)c1F |
| InChI | InChI=1S/C14H8F2N4O/c15-12-9(3-4-19-13(12)16)14(21)20-8-1-2-10-11(7-8)18-6-5-17-10/h1-7H,(H,20,21) |
| InChIKey | QWBKXIDUHXPLTR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|