C13H8F2N4O — CID 105380728
2,3-difluoro-N-(1H-indazol-6-yl)pyridine-4-carboxamide (PubChem CID 105380728) has the molecular formula C13H8F2N4O and a molecular weight of 274.23 g/mol. Its IUPAC name is 2,3-difluoro-N-(1H-indazol-6-yl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(1H-indazol-6-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380728 |
| Molecular Formula | C13H8F2N4O |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2,3-difluoro-N-(1H-indazol-6-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)c1ccnc(F)c1F |
| InChI | InChI=1S/C13H8F2N4O/c14-11-9(3-4-16-12(11)15)13(20)18-8-2-1-7-6-17-19-10(7)5-8/h1-6H,(H,17,19)(H,18,20) |
| InChIKey | CAHWQCMBKNSXTF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|