C13H8F4N2O — CID 103585463
N-(2,5-difluoro-4-methylphenyl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 103585463) has the molecular formula C13H8F4N2O and a molecular weight of 284.21 g/mol. Its IUPAC name is N-(2,5-difluoro-4-methylphenyl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(2,5-difluoro-4-methylphenyl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103585463 |
| Molecular Formula | C13H8F4N2O |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-(2,5-difluoro-4-methylphenyl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | Cc1cc(F)c(NC(=O)c2ccnc(F)c2F)cc1F |
| InChI | InChI=1S/C13H8F4N2O/c1-6-4-9(15)10(5-8(6)14)19-13(20)7-2-3-18-12(17)11(7)16/h2-5H,1H3,(H,19,20) |
| InChIKey | VTYLCMHLDJHYGJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|