C12H8BrF2NO2 — CID 106854464
2-bromo-N-(2,5-difluoro-4-methylphenyl)furan-3-carboxamide (PubChem CID 106854464) has the molecular formula C12H8BrF2NO2 and a molecular weight of 316.10 g/mol. Its IUPAC name is 2-bromo-N-(2,5-difluoro-4-methylphenyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(2,5-difluoro-4-methylphenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106854464 |
| Molecular Formula | C12H8BrF2NO2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 2-bromo-N-(2,5-difluoro-4-methylphenyl)furan-3-carboxamide |
| SMILES | Cc1cc(F)c(NC(=O)c2ccoc2Br)cc1F |
| InChI | InChI=1S/C12H8BrF2NO2/c1-6-4-9(15)10(5-8(6)14)16-12(17)7-2-3-18-11(7)13/h2-5H,1H3,(H,16,17) |
| InChIKey | NQUGIXRBGCLEHG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |