C14H10ClF2NOS — CID 107037172
2-chloro-N-(2,5-difluoro-4-methylphenyl)-5-sulfanylbenzamide (PubChem CID 107037172) has the molecular formula C14H10ClF2NOS and a molecular weight of 313.76 g/mol. Its IUPAC name is 2-chloro-N-(2,5-difluoro-4-methylphenyl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(2,5-difluoro-4-methylphenyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107037172 |
| Molecular Formula | C14H10ClF2NOS |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 2-chloro-N-(2,5-difluoro-4-methylphenyl)-5-sulfanylbenzamide |
| SMILES | Cc1cc(F)c(NC(=O)c2cc(S)ccc2Cl)cc1F |
| InChI | InChI=1S/C14H10ClF2NOS/c1-7-4-12(17)13(6-11(7)16)18-14(19)9-5-8(20)2-3-10(9)15/h2-6,20H,1H3,(H,18,19) |
| InChIKey | NJIAEEWCDOWPAP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|