C13H7ClF3NOS — CID 107031496
2-chloro-5-sulfanyl-N-(2,4,6-trifluorophenyl)benzamide (PubChem CID 107031496) has the molecular formula C13H7ClF3NOS and a molecular weight of 317.72 g/mol. Its IUPAC name is 2-chloro-5-sulfanyl-N-(2,4,6-trifluorophenyl)benzamide.
| Compound Name | 2-chloro-5-sulfanyl-N-(2,4,6-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 107031496 |
| Molecular Formula | C13H7ClF3NOS |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 2-chloro-5-sulfanyl-N-(2,4,6-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1F)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C13H7ClF3NOS/c14-9-2-1-7(20)5-8(9)13(19)18-12-10(16)3-6(15)4-11(12)17/h1-5,20H,(H,18,19) |
| InChIKey | LMLXZAXRCAQMSF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|