C13H7ClFN3OS2 — CID 107031240
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-fluoro-5-sulfanylbenzamide (PubChem CID 107031240) has the molecular formula C13H7ClFN3OS2 and a molecular weight of 339.80 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107031240 |
| Molecular Formula | C13H7ClFN3OS2 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-fluoro-5-sulfanylbenzamide |
| SMILES | O=C(Nc1c(Cl)ccc2nsnc12)c1cc(S)ccc1F |
| InChI | InChI=1S/C13H7ClFN3OS2/c14-8-2-4-10-12(18-21-17-10)11(8)16-13(19)7-5-6(20)1-3-9(7)15/h1-5,20H,(H,16,19) |
| InChIKey | BDXKRLWPIDLFND-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|