C13H6Cl3N3OS — CID 17274617
2,5-dichloro-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)benzamide (PubChem CID 17274617) has the molecular formula C13H6Cl3N3OS and a molecular weight of 358.64 g/mol. Its IUPAC name is 2,5-dichloro-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 17274617 |
| Molecular Formula | C13H6Cl3N3OS |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 2,5-dichloro-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)benzamide |
| SMILES | O=C(Nc1c(Cl)ccc2nsnc12)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H6Cl3N3OS/c14-6-1-2-8(15)7(5-6)13(20)17-11-9(16)3-4-10-12(11)19-21-18-10/h1-5H,(H,17,20) |
| InChIKey | GTUNPJHVZBPHJE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |