C13H8ClN3O3S — CID 136904601
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3,4-dihydroxybenzamide (PubChem CID 136904601) has the molecular formula C13H8ClN3O3S and a molecular weight of 321.75 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3,4-dihydroxybenzamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 136904601 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3,4-dihydroxybenzamide |
| SMILES | O=C(Nc1c(Cl)ccc2nsnc12)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H8ClN3O3S/c14-7-2-3-8-12(17-21-16-8)11(7)15-13(20)6-1-4-9(18)10(19)5-6/h1-5,18-19H,(H,15,20) |
| InChIKey | ZITKWEOOFRHSCM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|