C10H10ClN3OS — CID 17335846
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanamide (PubChem CID 17335846) has the molecular formula C10H10ClN3OS and a molecular weight of 255.73 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 17335846 |
| Molecular Formula | C10H10ClN3OS |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C10H10ClN3OS/c1-5(2)10(15)12-8-6(11)3-4-7-9(8)14-16-13-7/h3-5H,1-2H3,(H,12,15) |
| InChIKey | UUWDXJIMUPPERU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |