C11H11ClN4O3S — CID 65451539
3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]butanoic acid (PubChem CID 65451539) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is 3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]butanoic acid.
| Compound Name | 3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 65451539 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C11H11ClN4O3S/c1-5(4-8(17)18)13-11(19)14-9-6(12)2-3-7-10(9)16-20-15-7/h2-3,5H,4H2,1H3,(H,17,18)(H2,13,14,19) |
| InChIKey | SDVYMAXVZJXLQD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |