C8H6ClN3OS — CID 2994664
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)acetamide (PubChem CID 2994664) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)acetamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 2994664 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)acetamide |
| SMILES | CC(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C8H6ClN3OS/c1-4(13)10-7-5(9)2-3-6-8(7)12-14-11-6/h2-3H,1H3,(H,10,13) |
| InChIKey | GSQPORYNHPKRQP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |