C9H6ClN3O2S — CID 103252294
(E)-3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]prop-2-enoic acid (PubChem CID 103252294) has the molecular formula C9H6ClN3O2S and a molecular weight of 255.69 g/mol. Its IUPAC name is (E)-3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]prop-2-enoic acid.
| Compound Name | (E)-3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103252294 |
| Molecular Formula | C9H6ClN3O2S |
| Molecular Weight | 255.69 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (E)-3-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C9H6ClN3O2S/c10-5-1-2-6-9(13-16-12-6)8(5)11-4-3-7(14)15/h1-4,11H,(H,14,15)/b4-3+ |
| InChIKey | LQGHKZIIHRYQOH-ONEGZZNKSA-N |
| XLogP | 2.35 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.69 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|