C18H16ClN3OS — CID 17313300
(E)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 17313300) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is (E)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17313300 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | (E)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)Nc2c(Cl)ccc3nsnc23)cc1 |
| InChI | InChI=1S/C18H16ClN3OS/c1-11(2)13-6-3-12(4-7-13)5-10-16(23)20-17-14(19)8-9-15-18(17)22-24-21-15/h3-11H,1-2H3,(H,20,23)/b10-5+ |
| InChIKey | ISVJNFONKCRCSR-BJMVGYQFSA-N |
| XLogP | 5.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|