C9H7ClN4OS2 — CID 65476115
3-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-sulfanylidenepropanamide (PubChem CID 65476115) has the molecular formula C9H7ClN4OS2 and a molecular weight of 286.77 g/mol. Its IUPAC name is 3-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 65476115 |
| Molecular Formula | C9H7ClN4OS2 |
| Molecular Weight | 286.77 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 3-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-3-sulfanylidenepropanamide |
| SMILES | NC(=S)CC(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C9H7ClN4OS2/c10-4-1-2-5-9(14-17-13-5)8(4)12-7(15)3-6(11)16/h1-2H,3H2,(H2,11,16)(H,12,15) |
| InChIKey | WVIQZXRDHWPBJL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.77 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|