C14H19ClN4OS — CID 65473951
6-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-ethylhexanamide (PubChem CID 65473951) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is 6-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-ethylhexanamide.
| Compound Name | 6-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-ethylhexanamide |
|---|---|
| PubChem CID | 65473951 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6-amino-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-4-ethylhexanamide |
| SMILES | CCC(CCN)CCC(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C14H19ClN4OS/c1-2-9(7-8-16)3-6-12(20)17-13-10(15)4-5-11-14(13)19-21-18-11/h4-5,9H,2-3,6-8,16H2,1H3,(H,17,20) |
| InChIKey | CVOCUHQGLCUABK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |