C16H11BrClN3O2S — CID 17274505
(E)-3-(5-bromo-2-methoxyphenyl)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)prop-2-enamide (PubChem CID 17274505) has the molecular formula C16H11BrClN3O2S and a molecular weight of 424.71 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17274505 |
| Molecular Formula | C16H11BrClN3O2S |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C16H11BrClN3O2S/c1-23-13-6-3-10(17)8-9(13)2-7-14(22)19-15-11(18)4-5-12-16(15)21-24-20-12/h2-8H,1H3,(H,19,22)/b7-2+ |
| InChIKey | MTJFRRUXVBVVNS-FARCUNLSSA-N |
| XLogP | 4.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|